C11H15N5S2 — CID 53471094
2-tert-butyl-1,1-bis(1,3-thiazol-2-yl)guanidine (PubChem CID 53471094) has the molecular formula C11H15N5S2 and a molecular weight of 281.41 g/mol. Its IUPAC name is 2-tert-butyl-1,1-bis(1,3-thiazol-2-yl)guanidine.
| Compound Name | 2-tert-butyl-1,1-bis(1,3-thiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 53471094 |
| Molecular Formula | C11H15N5S2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-tert-butyl-1,1-bis(1,3-thiazol-2-yl)guanidine |
| SMILES | CC(C)(C)/N=C(\N)N(c1nccs1)c1nccs1 |
| InChI | InChI=1S/C11H15N5S2/c1-11(2,3)15-8(12)16(9-13-4-6-17-9)10-14-5-7-18-10/h4-7H,1-3H3,(H2,12,15) |
| InChIKey | BWRGKCJZMLZNJD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|