C10H4F2KNO2 — CID 53488056
potassium (Z)-3-cyano-3-(2,5-difluorophenyl)prop-2-enoate (PubChem CID 53488056) has the molecular formula C10H4F2KNO2 and a molecular weight of 247.24 g/mol. Its IUPAC name is potassium (Z)-3-cyano-3-(2,5-difluorophenyl)prop-2-enoate.
| Compound Name | potassium (Z)-3-cyano-3-(2,5-difluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 53488056 |
| Molecular Formula | C10H4F2KNO2 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | potassium (Z)-3-cyano-3-(2,5-difluorophenyl)prop-2-enoate |
| SMILES | N#C/C(=C\C(=O)[O-])c1cc(F)ccc1F.[K+] |
| InChI | InChI=1S/C10H5F2NO2.K/c11-7-1-2-9(12)8(4-7)6(5-13)3-10(14)15;/h1-4H,(H,14,15);/q;+1/p-1/b6-3+; |
| InChIKey | IPCGCZAWUPZJOO-ZIKNSQGESA-M |
| XLogP | -2.37 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_E(1)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|