C15H11NO4S — CID 5399294
(3Z)-3-[hydroxy(phenyl)methylidene]-1,1-dioxo-1λ6,2-benzothiazin-4-one (PubChem CID 5399294) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is (3Z)-3-[hydroxy(phenyl)methylidene]-1,1-dioxo-1λ6,2-benzothiazin-4-one.
| Compound Name | (3Z)-3-[hydroxy(phenyl)methylidene]-1,1-dioxo-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 5399294 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | (3Z)-3-[hydroxy(phenyl)methylidene]-1,1-dioxo-1λ6,2-benzothiazin-4-one |
| SMILES | O=C1/C(=C(/O)c2ccccc2)NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C15H11NO4S/c17-14(10-6-2-1-3-7-10)13-15(18)11-8-4-5-9-12(11)21(19,20)16-13/h1-9,16-17H/b14-13- |
| InChIKey | KHLZLOGKPUQCLP-YPKPFQOOSA-N |
| XLogP | 2.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|