C19H27N5O5 — CID 54031410
4-cyclopentyl-3-[[2-[[3-(diaminomethylamino)benzoyl]amino]acetyl]amino]-4-oxobutanoic acid (PubChem CID 54031410) has the molecular formula C19H27N5O5 and a molecular weight of 405.46 g/mol. Its IUPAC name is 4-cyclopentyl-3-[[2-[[3-(diaminomethylamino)benzoyl]amino]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-cyclopentyl-3-[[2-[[3-(diaminomethylamino)benzoyl]amino]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54031410 |
| Molecular Formula | C19H27N5O5 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 4-cyclopentyl-3-[[2-[[3-(diaminomethylamino)benzoyl]amino]acetyl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)Nc1cccc(C(=O)NCC(=O)NC(CC(=O)O)C(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C19H27N5O5/c20-19(21)23-13-7-3-6-12(8-13)18(29)22-10-15(25)24-14(9-16(26)27)17(28)11-4-1-2-5-11/h3,6-8,11,14,19,23H,1-2,4-5,9-10,20-21H2,(H,22,29)(H,24,25)(H,26,27) |
| InChIKey | LFWANMUMYSIZSF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|