C10H9ClF3NO2S — CID 54115419
1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpropan-2-imine (PubChem CID 54115419) has the molecular formula C10H9ClF3NO2S and a molecular weight of 299.70 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpropan-2-imine.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpropan-2-imine |
|---|---|
| PubChem CID | 54115419 |
| Molecular Formula | C10H9ClF3NO2S |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpropan-2-imine |
| SMILES | [H]/N=C(\C)CS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9ClF3NO2S/c1-6(15)5-18(16,17)7-2-3-9(11)8(4-7)10(12,13)14/h2-4,15H,5H2,1H3/b15-6+ |
| InChIKey | NJZRDDUISFIXPN-GIDUJCDVSA-N |
| XLogP | 3.17 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|