C20H25ClO3 — CID 54132776
9-(3-chloro-4-methoxy-2,6-dimethylphenyl)-3,7-dimethylnona-2,6,8-trienoic acid (PubChem CID 54132776) has the molecular formula C20H25ClO3 and a molecular weight of 348.87 g/mol. Its IUPAC name is 9-(3-chloro-4-methoxy-2,6-dimethylphenyl)-3,7-dimethylnona-2,6,8-trienoic acid.
| Compound Name | 9-(3-chloro-4-methoxy-2,6-dimethylphenyl)-3,7-dimethylnona-2,6,8-trienoic acid |
|---|---|
| PubChem CID | 54132776 |
| Molecular Formula | C20H25ClO3 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 9-(3-chloro-4-methoxy-2,6-dimethylphenyl)-3,7-dimethylnona-2,6,8-trienoic acid |
| SMILES | COc1cc(C)c(C=CC(C)=CCCC(C)=CC(=O)O)c(C)c1Cl |
| InChI | InChI=1S/C20H25ClO3/c1-13(7-6-8-14(2)11-19(22)23)9-10-17-15(3)12-18(24-5)20(21)16(17)4/h7,9-12H,6,8H2,1-5H3,(H,22,23) |
| InChIKey | NVNFBMPVYGVKHE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|