C28H44O3 — CID 54170261
1-[dec-9-enoxy(3,7-dimethylocta-2,6-dienoxy)methyl]-4-methoxybenzene (PubChem CID 54170261) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is 1-[dec-9-enoxy(3,7-dimethylocta-2,6-dienoxy)methyl]-4-methoxybenzene.
| Compound Name | 1-[dec-9-enoxy(3,7-dimethylocta-2,6-dienoxy)methyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 54170261 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | 1-[dec-9-enoxy(3,7-dimethylocta-2,6-dienoxy)methyl]-4-methoxybenzene |
| SMILES | C=CCCCCCCCCOC(OCC=C(C)CCC=C(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H44O3/c1-6-7-8-9-10-11-12-13-22-30-28(26-17-19-27(29-5)20-18-26)31-23-21-25(4)16-14-15-24(2)3/h6,15,17-21,28H,1,7-14,16,22-23H2,2-5H3 |
| InChIKey | OUNGHWDIPBBTBO-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|