C14H11Cl2N3O2S2 — CID 54209261
[2,5-bis(chlorosulfanyl)phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 54209261) has the molecular formula C14H11Cl2N3O2S2 and a molecular weight of 388.30 g/mol. Its IUPAC name is [2,5-bis(chlorosulfanyl)phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [2,5-bis(chlorosulfanyl)phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 54209261 |
| Molecular Formula | C14H11Cl2N3O2S2 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | [2,5-bis(chlorosulfanyl)phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2cc(SCl)ccc2SCl)cc1 |
| InChI | InChI=1S/C14H11Cl2N3O2S2/c15-22-10-5-6-12(23-16)11(7-10)21-13(20)8-1-3-9(4-2-8)19-14(17)18/h1-7H,(H4,17,18,19) |
| InChIKey | PUUDYLKGKYOELX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|