C30H32N2O10 — CID 54232591
2-[[3-(2-acetyloxyethoxycarbonyl)-5-ethylphenyl]carbamoyl]-4-[4-(hydroperoxymethyl)-3-(methylaminooxymethyl)phenyl]benzoic acid (PubChem CID 54232591) has the molecular formula C30H32N2O10 and a molecular weight of 580.59 g/mol. Its IUPAC name is 2-[[3-(2-acetyloxyethoxycarbonyl)-5-ethylphenyl]carbamoyl]-4-[4-(hydroperoxymethyl)-3-(methylaminooxymethyl)phenyl]benzoic acid.
| Compound Name | 2-[[3-(2-acetyloxyethoxycarbonyl)-5-ethylphenyl]carbamoyl]-4-[4-(hydroperoxymethyl)-3-(methylaminooxymethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 54232591 |
| Molecular Formula | C30H32N2O10 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 2-[[3-(2-acetyloxyethoxycarbonyl)-5-ethylphenyl]carbamoyl]-4-[4-(hydroperoxymethyl)-3-(methylaminooxymethyl)phenyl]benzoic acid |
| SMILES | CCc1cc(NC(=O)c2cc(-c3ccc(COO)c(CONC)c3)ccc2C(=O)O)cc(C(=O)OCCOC(C)=O)c1 |
| InChI | InChI=1S/C30H32N2O10/c1-4-19-11-23(30(37)40-10-9-39-18(2)33)14-25(12-19)32-28(34)27-15-21(7-8-26(27)29(35)36)20-5-6-22(17-42-38)24(13-20)16-41-31-3/h5-8,11-15,31,38H,4,9-10,16-17H2,1-3H3,(H,32,34)(H,35,36) |
| InChIKey | QKIFILMUHWATSZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|