C32H36N3O10 — CID 59945390
CID 59945390 (PubChem CID 59945390) has the molecular formula C32H36N3O10 and a molecular weight of 622.65 g/mol.
| Compound Name | CID 59945390 |
|---|---|
| PubChem CID | 59945390 |
| Molecular Formula | C32H36N3O10 |
| Molecular Weight | 622.65 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | — |
| SMILES | CNOCc1cc(-c2ccc(C(=O)O)c(C(=O)Nc3cc([CH]C(=O)OCCOC(=O)C(C)C)cc(NC)c3)c2)ccc1COO |
| InChI | InChI=1S/C32H36N3O10/c1-19(2)32(40)43-10-9-42-29(36)13-20-11-25(33-3)16-26(12-20)35-30(37)28-15-22(7-8-27(28)31(38)39)21-5-6-23(18-45-41)24(14-21)17-44-34-4/h5-8,11-16,19,33-34,41H,9-10,17-18H2,1-4H3,(H,35,37)(H,38,39) |
| InChIKey | OGVOEYCAXGPNTA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 181.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|