C7H8ClF3N4S — CID 54248069
1-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(2,2,2-trifluoroethyl)guanidine (PubChem CID 54248069) has the molecular formula C7H8ClF3N4S and a molecular weight of 272.68 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 54248069 |
| Molecular Formula | C7H8ClF3N4S |
| Molecular Weight | 272.68 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(2,2,2-trifluoroethyl)guanidine |
| SMILES | [H]/N=C(\N)N(CC(F)(F)F)c1nc(CCl)cs1 |
| InChI | InChI=1S/C7H8ClF3N4S/c8-1-4-2-16-6(14-4)15(5(12)13)3-7(9,10)11/h2H,1,3H2,(H3,12,13) |
| InChIKey | QUSMZXXKERJEJP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.68 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|