C24H24N2O8 — CID 54273964
bis(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) hexanedioate (PubChem CID 54273964) has the molecular formula C24H24N2O8 and a molecular weight of 468.46 g/mol. Its IUPAC name is bis(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) hexanedioate.
| Compound Name | bis(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) hexanedioate |
|---|---|
| PubChem CID | 54273964 |
| Molecular Formula | C24H24N2O8 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | bis(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) hexanedioate |
| SMILES | O=C(CCCCC(=O)On1c(O)c2c(c1O)C1C=CC2C1)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C24H24N2O8/c27-15(33-25-21(29)17-11-5-6-12(9-11)18(17)22(25)30)3-1-2-4-16(28)34-26-23(31)19-13-7-8-14(10-13)20(19)24(26)32/h5-8,11-14,29-32H,1-4,9-10H2 |
| InChIKey | RMCKEOZUQKYXPX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|