C25H40N2O2 — CID 54276723
(4aS,8aR)-1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3,3-dimethyl-4a,5,6,7,8,8a-hexahydro-4H-quinoxalin-2-one (PubChem CID 54276723) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is (4aS,8aR)-1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3,3-dimethyl-4a,5,6,7,8,8a-hexahydro-4H-quinoxalin-2-one.
| Compound Name | (4aS,8aR)-1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3,3-dimethyl-4a,5,6,7,8,8a-hexahydro-4H-quinoxalin-2-one |
|---|---|
| PubChem CID | 54276723 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | (4aS,8aR)-1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3,3-dimethyl-4a,5,6,7,8,8a-hexahydro-4H-quinoxalin-2-one |
| SMILES | CC1(C)N[C@H]2CCCC[C@H]2N(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C1=O |
| InChI | InChI=1S/C25H40N2O2/c1-23(2,3)17-13-16(14-18(21(17)28)24(4,5)6)15-27-20-12-10-9-11-19(20)26-25(7,8)22(27)29/h13-14,19-20,26,28H,9-12,15H2,1-8H3/t19-,20+/m0/s1 |
| InChIKey | RNXMDXUKQBRLJH-VQTJNVASSA-N |
| XLogP | 5.01 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |