C16H21NO7S — CID 54390901
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)peroxysulfinylmethyl 2,2-dimethylbutanoate (PubChem CID 54390901) has the molecular formula C16H21NO7S and a molecular weight of 371.41 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)peroxysulfinylmethyl 2,2-dimethylbutanoate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)peroxysulfinylmethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 54390901 |
| Molecular Formula | C16H21NO7S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)peroxysulfinylmethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCS(=O)OOn1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C16H21NO7S/c1-4-16(2,3)15(20)22-8-25(21)24-23-17-13(18)11-9-5-6-10(7-9)12(11)14(17)19/h5-6,9-10,18-19H,4,7-8H2,1-3H3 |
| InChIKey | VGODWKBSBXYQRU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|