About 2-(1,3-thiazol-2-yloxyimino)acetyl chloride
2-(1,3-thiazol-2-yloxyimino)acetyl chloride (PubChem CID 54411805) has the molecular formula C5H3ClN2O2S
and a molecular weight of 190.61 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yloxyimino)acetyl chloride.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-yloxyimino)acetyl chloride |
| PubChem CID | 54411805 |
| Molecular Formula | C5H3ClN2O2S |
| Molecular Weight | 190.61 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | 2-(1,3-thiazol-2-yloxyimino)acetyl chloride |
| SMILES | O=C(Cl)C=NOc1nccs1 |
| InChI | InChI=1S/C5H3ClN2O2S/c6-4(9)3-8-10-5-7-1-2-11-5/h1-3H |
| InChIKey | VUQPZBLZTMOAGO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.61 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-thiazol-2-yloxyimino)acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-yloxyimino)acetyl chloride?
The IUPAC name of 2-(1,3-thiazol-2-yloxyimino)acetyl chloride (CID 54411805) is 2-(1,3-thiazol-2-yloxyimino)acetyl chloride.
What is the SMILES notation for 2-(1,3-thiazol-2-yloxyimino)acetyl chloride?
The canonical SMILES for 2-(1,3-thiazol-2-yloxyimino)acetyl chloride is O=C(Cl)C=NOc1nccs1.
What is the InChIKey of 2-(1,3-thiazol-2-yloxyimino)acetyl chloride?
The InChIKey is VUQPZBLZTMOAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN2O2S/c6-4(9)3-8-10-5-7-1-2-11-5/h1-3H.
What are the key properties of 2-(1,3-thiazol-2-yloxyimino)acetyl chloride?
2-(1,3-thiazol-2-yloxyimino)acetyl chloride has a molecular weight of 190.61 g/mol, XLogP of 1.27, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-yloxyimino)acetyl chloride is sourced from PubChem (CID 54411805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).