C34H72N4 — CID 54436358
N,N'-diethyl-N'-[2-[ethyl-[2-[ethyl(3,7,11,15-tetramethylhexadec-2-enyl)amino]ethyl]amino]ethyl]ethane-1,2-diamine (PubChem CID 54436358) has the molecular formula C34H72N4 and a molecular weight of 536.98 g/mol. Its IUPAC name is N,N'-diethyl-N'-[2-[ethyl-[2-[ethyl(3,7,11,15-tetramethylhexadec-2-enyl)amino]ethyl]amino]ethyl]ethane-1,2-diamine.
| Compound Name | N,N'-diethyl-N'-[2-[ethyl-[2-[ethyl(3,7,11,15-tetramethylhexadec-2-enyl)amino]ethyl]amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 54436358 |
| Molecular Formula | C34H72N4 |
| Molecular Weight | 536.98 g/mol |
| Exact Mass | 536.58 |
| IUPAC Name | N,N'-diethyl-N'-[2-[ethyl-[2-[ethyl(3,7,11,15-tetramethylhexadec-2-enyl)amino]ethyl]amino]ethyl]ethane-1,2-diamine |
| SMILES | CCNCCN(CC)CCN(CC)CCN(CC)CC=C(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C34H72N4/c1-10-35-24-26-37(12-3)28-30-38(13-4)29-27-36(11-2)25-23-34(9)22-16-21-33(8)20-15-19-32(7)18-14-17-31(5)6/h23,31-33,35H,10-22,24-30H2,1-9H3 |
| InChIKey | WKZXFOAGDWSJBA-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.98 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|