C20H27NO5 — CID 54461269
tert-butyl N-[3-(3,4,8-trimethyl-2-oxochromen-7-yl)oxypropyl]carbamate (PubChem CID 54461269) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl N-[3-(3,4,8-trimethyl-2-oxochromen-7-yl)oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(3,4,8-trimethyl-2-oxochromen-7-yl)oxypropyl]carbamate |
|---|---|
| PubChem CID | 54461269 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | tert-butyl N-[3-(3,4,8-trimethyl-2-oxochromen-7-yl)oxypropyl]carbamate |
| SMILES | Cc1c(C)c2ccc(OCCCNC(=O)OC(C)(C)C)c(C)c2oc1=O |
| InChI | InChI=1S/C20H27NO5/c1-12-13(2)18(22)25-17-14(3)16(9-8-15(12)17)24-11-7-10-21-19(23)26-20(4,5)6/h8-9H,7,10-11H2,1-6H3,(H,21,23) |
| InChIKey | XBUFWMGBBLLFRT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|