C24H27NO — CID 54471373
2,2,4,5,6,7,8,9-octamethyl-1H-indeno[1,2-g]quinolin-10-one (PubChem CID 54471373) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is 2,2,4,5,6,7,8,9-octamethyl-1H-indeno[1,2-g]quinolin-10-one.
| Compound Name | 2,2,4,5,6,7,8,9-octamethyl-1H-indeno[1,2-g]quinolin-10-one |
|---|---|
| PubChem CID | 54471373 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2,2,4,5,6,7,8,9-octamethyl-1H-indeno[1,2-g]quinolin-10-one |
| SMILES | CC1=CC(C)(C)Nc2cc3c(c(C)c21)-c1c(C)c(C)c(C)c(C)c1C3=O |
| InChI | InChI=1S/C24H27NO/c1-11-10-24(7,8)25-18-9-17-20(16(6)19(11)18)21-14(4)12(2)13(3)15(5)22(21)23(17)26/h9-10,25H,1-8H3 |
| InChIKey | XIPKPBQHOKYXLL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |