C37H37N3O7 — CID 54590746
2-[(2R,3S,4R,5S,6S)-4-azido-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl]-8-(methoxymethoxy)-5-phenylmethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one (PubChem CID 54590746) has the molecular formula C37H37N3O7 and a molecular weight of 635.72 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5S,6S)-4-azido-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl]-8-(methoxymethoxy)-5-phenylmethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one.
| Compound Name | 2-[(2R,3S,4R,5S,6S)-4-azido-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl]-8-(methoxymethoxy)-5-phenylmethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one |
|---|---|
| PubChem CID | 54590746 |
| Molecular Formula | C37H37N3O7 |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | 2-[(2R,3S,4R,5S,6S)-4-azido-6-methyl-3,5-bis(phenylmethoxy)oxan-2-yl]-8-(methoxymethoxy)-5-phenylmethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one |
| SMILES | COCOC1C(=O)c2c(OCc3ccccc3)ccc([C@H]3O[C@@H](C)[C@@H](OCc4ccccc4)[C@@H](N=[N+]=[N-])[C@@H]3OCc3ccccc3)c21 |
| InChI | InChI=1S/C37H37N3O7/c1-24-34(44-21-26-14-8-4-9-15-26)32(39-40-38)37(45-22-27-16-10-5-11-17-27)35(47-24)28-18-19-29(43-20-25-12-6-3-7-13-25)31-30(28)36(33(31)41)46-23-42-2/h3-19,24,32,34-37H,20-23H2,1-2H3/t24-,32+,34+,35+,36?,37-/m0/s1 |
| InChIKey | YOWRCLKZBLTJCU-FQXJYNLESA-N |
| XLogP | 7.43 |
| TPSA | 121.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|