C40H41N3O7 — CID 11104359
(2R,3S,4R,5S,6S)-4-azido-2-[5-methoxy-8-(methoxymethoxy)-4-phenylmethoxynaphthalen-1-yl]-6-methyl-3,5-bis(phenylmethoxy)oxane (PubChem CID 11104359) has the molecular formula C40H41N3O7 and a molecular weight of 675.78 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-4-azido-2-[5-methoxy-8-(methoxymethoxy)-4-phenylmethoxynaphthalen-1-yl]-6-methyl-3,5-bis(phenylmethoxy)oxane.
| Compound Name | (2R,3S,4R,5S,6S)-4-azido-2-[5-methoxy-8-(methoxymethoxy)-4-phenylmethoxynaphthalen-1-yl]-6-methyl-3,5-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 11104359 |
| Molecular Formula | C40H41N3O7 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.29 |
| IUPAC Name | (2R,3S,4R,5S,6S)-4-azido-2-[5-methoxy-8-(methoxymethoxy)-4-phenylmethoxynaphthalen-1-yl]-6-methyl-3,5-bis(phenylmethoxy)oxane |
| SMILES | COCOc1ccc(OC)c2c(OCc3ccccc3)ccc([C@H]3O[C@@H](C)[C@@H](OCc4ccccc4)C(N=[N+]=[N-])[C@@H]3OCc3ccccc3)c12 |
| InChI | InChI=1S/C40H41N3O7/c1-27-38(47-24-29-15-9-5-10-16-29)37(42-43-41)40(48-25-30-17-11-6-12-18-30)39(50-27)31-19-20-34(46-23-28-13-7-4-8-14-28)36-32(45-3)21-22-33(35(31)36)49-26-44-2/h4-22,27,37-40H,23-26H2,1-3H3/t27-,37?,38+,39+,40-/m0/s1 |
| InChIKey | LYSJHAXNSZRANI-PBJRQCHGSA-N |
| XLogP | 8.72 |
| TPSA | 113.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|