C33H37N3O11 — CID 54613777
(2R,3S,4S,5R,6R)-6-[(2R,3S,4R,5R)-5-azido-2-(hydroxymethyl)-4,6-bis(phenylmethoxy)oxan-3-yl]oxy-3,5-dihydroxy-4-phenylmethoxyoxane-2-carboxylic acid (PubChem CID 54613777) has the molecular formula C33H37N3O11 and a molecular weight of 651.67 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-6-[(2R,3S,4R,5R)-5-azido-2-(hydroxymethyl)-4,6-bis(phenylmethoxy)oxan-3-yl]oxy-3,5-dihydroxy-4-phenylmethoxyoxane-2-carboxylic acid.
| Compound Name | (2R,3S,4S,5R,6R)-6-[(2R,3S,4R,5R)-5-azido-2-(hydroxymethyl)-4,6-bis(phenylmethoxy)oxan-3-yl]oxy-3,5-dihydroxy-4-phenylmethoxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 54613777 |
| Molecular Formula | C33H37N3O11 |
| Molecular Weight | 651.67 g/mol |
| Exact Mass | 651.24 |
| IUPAC Name | (2R,3S,4S,5R,6R)-6-[(2R,3S,4R,5R)-5-azido-2-(hydroxymethyl)-4,6-bis(phenylmethoxy)oxan-3-yl]oxy-3,5-dihydroxy-4-phenylmethoxyoxane-2-carboxylic acid |
| SMILES | [N-]=[N+]=N[C@H]1C(OCc2ccccc2)O[C@H](CO)[C@@H](O[C@@H]2O[C@@H](C(=O)O)[C@@H](O)[C@H](OCc3ccccc3)[C@H]2O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H37N3O11/c34-36-35-24-28(42-17-20-10-4-1-5-11-20)27(23(16-37)45-32(24)44-19-22-14-8-3-9-15-22)46-33-26(39)29(25(38)30(47-33)31(40)41)43-18-21-12-6-2-7-13-21/h1-15,23-30,32-33,37-39H,16-19H2,(H,40,41)/t23-,24-,25+,26-,27-,28-,29+,30-,32?,33-/m1/s1 |
| InChIKey | KBZRBDHMBWHULG-VKFDHSLESA-N |
| XLogP | 2.69 |
| TPSA | 202.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.67 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|