C10H15NO3 — CID 54754849
N-[(4R,5R)-3,5-dihydroxyoct-1-en-7-yn-4-yl]acetamide (PubChem CID 54754849) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is N-[(4R,5R)-3,5-dihydroxyoct-1-en-7-yn-4-yl]acetamide.
| Compound Name | N-[(4R,5R)-3,5-dihydroxyoct-1-en-7-yn-4-yl]acetamide |
|---|---|
| PubChem CID | 54754849 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | N-[(4R,5R)-3,5-dihydroxyoct-1-en-7-yn-4-yl]acetamide |
| SMILES | C#CC[C@@H](O)[C@@H](NC(C)=O)C(O)C=C |
| InChI | InChI=1S/C10H15NO3/c1-4-6-9(14)10(8(13)5-2)11-7(3)12/h1,5,8-10,13-14H,2,6H2,3H3,(H,11,12)/t8?,9-,10+/m1/s1 |
| InChIKey | NNEDJFUVIWJDGQ-XVBQNVSMSA-N |
| XLogP | -0.58 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|