C14H19N3O3S — CID 5477899
[(Z)-[(E)-4-(3,4,5-trimethoxyphenyl)but-3-en-2-ylidene]amino]thiourea (PubChem CID 5477899) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is [(Z)-[(E)-4-(3,4,5-trimethoxyphenyl)but-3-en-2-ylidene]amino]thiourea.
| Compound Name | [(Z)-[(E)-4-(3,4,5-trimethoxyphenyl)but-3-en-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 5477899 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | [(Z)-[(E)-4-(3,4,5-trimethoxyphenyl)but-3-en-2-ylidene]amino]thiourea |
| SMILES | COc1cc(/C=C/C(C)=N\NC(N)=S)cc(OC)c1OC |
| InChI | InChI=1S/C14H19N3O3S/c1-9(16-17-14(15)21)5-6-10-7-11(18-2)13(20-4)12(8-10)19-3/h5-8H,1-4H3,(H3,15,17,21)/b6-5+,16-9- |
| InChIKey | YTTUUDPDUGHROI-NZXGZCDDSA-N |
| XLogP | 1.93 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|