About 3-hydroxybutylboronic acid
3-hydroxybutylboronic acid (PubChem CID 55255974) has the molecular formula C4H11BO3
and a molecular weight of 117.94 g/mol. Its IUPAC name is 3-hydroxybutylboronic acid.
Molecular Properties
| Compound Name | 3-hydroxybutylboronic acid |
| PubChem CID | 55255974 |
| Molecular Formula | C4H11BO3 |
| Molecular Weight | 117.94 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 3-hydroxybutylboronic acid |
| SMILES | CC(O)CCB(O)O |
| InChI | InChI=1S/C4H11BO3/c1-4(6)2-3-5(7)8/h4,6-8H,2-3H2,1H3 |
| InChIKey | BWHOKARUFGPODZ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.94 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxybutylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxybutylboronic acid?
The IUPAC name of 3-hydroxybutylboronic acid (CID 55255974) is 3-hydroxybutylboronic acid.
What is the SMILES notation for 3-hydroxybutylboronic acid?
The canonical SMILES for 3-hydroxybutylboronic acid is CC(O)CCB(O)O.
What is the InChIKey of 3-hydroxybutylboronic acid?
The InChIKey is BWHOKARUFGPODZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11BO3/c1-4(6)2-3-5(7)8/h4,6-8H,2-3H2,1H3.
What are the key properties of 3-hydroxybutylboronic acid?
3-hydroxybutylboronic acid has a molecular weight of 117.94 g/mol, XLogP of -0.77, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxybutylboronic acid is sourced from PubChem (CID 55255974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).