C17H14F3N3O4 — CID 55373198
3-(1,3-dioxoisoindol-2-yl)propyl 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate (PubChem CID 55373198) has the molecular formula C17H14F3N3O4 and a molecular weight of 381.31 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 55373198 |
| Molecular Formula | C17H14F3N3O4 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-[3-(trifluoromethyl)pyrazol-1-yl]acetate |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)OCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H14F3N3O4/c18-17(19,20)13-6-8-22(21-13)10-14(24)27-9-3-7-23-15(25)11-4-1-2-5-12(11)16(23)26/h1-2,4-6,8H,3,7,9-10H2 |
| InChIKey | XXZNLOMVIWYYOW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|