C20H15ClFN3O6 — CID 55572840
(2-chloro-4-cyano-6-ethoxyphenyl) 1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 55572840) has the molecular formula C20H15ClFN3O6 and a molecular weight of 447.81 g/mol. Its IUPAC name is (2-chloro-4-cyano-6-ethoxyphenyl) 1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-chloro-4-cyano-6-ethoxyphenyl) 1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 55572840 |
| Molecular Formula | C20H15ClFN3O6 |
| Molecular Weight | 447.81 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | (2-chloro-4-cyano-6-ethoxyphenyl) 1-(4-fluoro-3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOc1cc(C#N)cc(Cl)c1OC(=O)C1CC(=O)N(c2ccc(F)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C20H15ClFN3O6/c1-2-30-17-6-11(9-23)5-14(21)19(17)31-20(27)12-7-18(26)24(10-12)13-3-4-15(22)16(8-13)25(28)29/h3-6,8,12H,2,7,10H2,1H3 |
| InChIKey | JRTKAURDHJPLMX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 122.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.81 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|