C19H23F3N4O3S2 — CID 55617615
2-(benzenesulfonamido)-4-methylsulfanyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide (PubChem CID 55617615) has the molecular formula C19H23F3N4O3S2 and a molecular weight of 476.55 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-4-methylsulfanyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide.
| Compound Name | 2-(benzenesulfonamido)-4-methylsulfanyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide |
|---|---|
| PubChem CID | 55617615 |
| Molecular Formula | C19H23F3N4O3S2 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 2-(benzenesulfonamido)-4-methylsulfanyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1)C(=O)NCCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H23F3N4O3S2/c1-30-12-9-16(26-31(28,29)15-5-3-2-4-6-15)18(27)24-11-10-23-17-8-7-14(13-25-17)19(20,21)22/h2-8,13,16,26H,9-12H2,1H3,(H,23,25)(H,24,27) |
| InChIKey | FHYSDBVMVNAHBW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|