C21H25N5O5S — CID 55680811
4-[4-[(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)methyl]phenyl]piperazin-2-one (PubChem CID 55680811) has the molecular formula C21H25N5O5S and a molecular weight of 459.53 g/mol. Its IUPAC name is 4-[4-[(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)methyl]phenyl]piperazin-2-one.
| Compound Name | 4-[4-[(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)methyl]phenyl]piperazin-2-one |
|---|---|
| PubChem CID | 55680811 |
| Molecular Formula | C21H25N5O5S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 4-[4-[(4-nitro-2-pyrrolidin-1-ylsulfonylanilino)methyl]phenyl]piperazin-2-one |
| SMILES | O=C1CN(c2ccc(CNc3ccc([N+](=O)[O-])cc3S(=O)(=O)N3CCCC3)cc2)CCN1 |
| InChI | InChI=1S/C21H25N5O5S/c27-21-15-24(12-9-22-21)17-5-3-16(4-6-17)14-23-19-8-7-18(26(28)29)13-20(19)32(30,31)25-10-1-2-11-25/h3-8,13,23H,1-2,9-12,14-15H2,(H,22,27) |
| InChIKey | OEDFKMAHDVRXFB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|