C19H17BrN6O2S — CID 55789095
1-(2-bromophenyl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 55789095) has the molecular formula C19H17BrN6O2S and a molecular weight of 473.36 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-bromophenyl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55789095 |
| Molecular Formula | C19H17BrN6O2S |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 1-(2-bromophenyl)-N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)C2CCN(c3ccccc3Br)C2=O)c1 |
| InChI | InChI=1S/C19H17BrN6O2S/c1-29-19-22-23-24-26(19)13-6-4-5-12(11-13)21-17(27)14-9-10-25(18(14)28)16-8-3-2-7-15(16)20/h2-8,11,14H,9-10H2,1H3,(H,21,27) |
| InChIKey | BQCKECOJSPWEPX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|