C21H25BrN2O3S2 — CID 55916501
N-[(4-bromophenyl)-cyclobutylmethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 55916501) has the molecular formula C21H25BrN2O3S2 and a molecular weight of 497.48 g/mol. Its IUPAC name is N-[(4-bromophenyl)-cyclobutylmethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(4-bromophenyl)-cyclobutylmethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55916501 |
| Molecular Formula | C21H25BrN2O3S2 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | N-[(4-bromophenyl)-cyclobutylmethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NC(c1ccc(Br)cc1)C1CCC1)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C21H25BrN2O3S2/c22-18-8-6-16(7-9-18)20(15-3-1-4-15)23-21(25)17-10-12-24(13-11-17)29(26,27)19-5-2-14-28-19/h2,5-9,14-15,17,20H,1,3-4,10-13H2,(H,23,25) |
| InChIKey | MGBWCBUALHVBMV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |