C24H27N3O3S2 — CID 55982260
6-(1,3-benzothiazol-2-yl)-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 55982260) has the molecular formula C24H27N3O3S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | 6-(1,3-benzothiazol-2-yl)-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 55982260 |
| Molecular Formula | C24H27N3O3S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CC(NC(=O)C1CC=CCC1c1nc2ccccc2s1)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C24H27N3O3S2/c1-16(17-12-14-18(15-13-17)32(29,30)27(2)3)25-23(28)19-8-4-5-9-20(19)24-26-21-10-6-7-11-22(21)31-24/h4-7,10-16,19-20H,8-9H2,1-3H3,(H,25,28) |
| InChIKey | HIBYZQZTKUQOIN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|