C19H19BrF2N2O3 — CID 56569688
N-[4-(4-bromo-2-methoxy-6-methylanilino)-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 56569688) has the molecular formula C19H19BrF2N2O3 and a molecular weight of 441.27 g/mol. Its IUPAC name is N-[4-(4-bromo-2-methoxy-6-methylanilino)-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-(4-bromo-2-methoxy-6-methylanilino)-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 56569688 |
| Molecular Formula | C19H19BrF2N2O3 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | N-[4-(4-bromo-2-methoxy-6-methylanilino)-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | COc1cc(Br)cc(C)c1NC(=O)CCCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H19BrF2N2O3/c1-11-8-12(20)9-16(27-2)18(11)24-17(25)4-3-7-23-19(26)14-6-5-13(21)10-15(14)22/h5-6,8-10H,3-4,7H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | CVQIIXUYYMALLM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|