About zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate
zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate (PubChem CID 56589537) has the molecular formula C10H11NO4Zn
and a molecular weight of 274.59 g/mol. Its IUPAC name is zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate.
Molecular Properties
| Compound Name | zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate |
| PubChem CID | 56589537 |
| Molecular Formula | C10H11NO4Zn |
| Molecular Weight | 274.59 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate |
| SMILES | C/C(=N\CC(=O)[O-])c1ccccc1[O-].O.[Zn+2] |
| InChI | InChI=1S/C10H11NO3.H2O.Zn/c1-7(11-6-10(13)14)8-4-2-3-5-9(8)12;;/h2-5,12H,6H2,1H3,(H,13,14);1H2;/q;;+2/p-2/b11-7+;; |
| InChIKey | GNTDFQLPXDRKGI-FCVAESPPSA-L |
| XLogP | -1.51 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.59 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate?
The IUPAC name of zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate (CID 56589537) is zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate.
What is the SMILES notation for zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate?
The canonical SMILES for zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate is C/C(=N\CC(=O)[O-])c1ccccc1[O-].O.[Zn+2].
What is the InChIKey of zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate?
The InChIKey is GNTDFQLPXDRKGI-FCVAESPPSA-L. The full InChI is InChI=1S/C10H11NO3.H2O.Zn/c1-7(11-6-10(13)14)8-4-2-3-5-9(8)12;;/h2-5,12H,6H2,1H3,(H,13,14);1H2;/q;;+2/p-2/b11-7+;;.
What are the key properties of zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate?
zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate has a molecular weight of 274.59 g/mol, XLogP of -1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2-[1-(2-oxidophenyl)ethylideneamino]acetate;hydrate is sourced from PubChem (CID 56589537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).