C24H31N3O3 — CID 56597959
4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-(furan-2-ylmethyl)piperidine-1-carboximidamide (PubChem CID 56597959) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-(furan-2-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | 4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-(furan-2-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 56597959 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]-N'-(furan-2-ylmethyl)piperidine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccco1)N1CCC(C(=O)[C@](O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C24H31N3O3/c25-23(26-17-21-11-6-16-30-21)27-14-12-18(13-15-27)22(28)24(29,20-9-4-5-10-20)19-7-2-1-3-8-19/h1-3,6-8,11,16,18,20,29H,4-5,9-10,12-15,17H2,(H2,25,26)/t24-/m0/s1 |
| InChIKey | IMTSZLULZGZSQX-DEOSSOPVSA-N |
| XLogP | 3.45 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|