C21H19F6N6O7S2+ — CID 56627919
[[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-[[2-(trifluoromethyl)phenyl]sulfonylamino]methylidene]-methoxy-[2-(trifluoromethyl)phenyl]sulfonylazanium (PubChem CID 56627919) has the molecular formula C21H19F6N6O7S2+ and a molecular weight of 645.54 g/mol. Its IUPAC name is [[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-[[2-(trifluoromethyl)phenyl]sulfonylamino]methylidene]-methoxy-[2-(trifluoromethyl)phenyl]sulfonylazanium.
| Compound Name | [[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-[[2-(trifluoromethyl)phenyl]sulfonylamino]methylidene]-methoxy-[2-(trifluoromethyl)phenyl]sulfonylazanium |
|---|---|
| PubChem CID | 56627919 |
| Molecular Formula | C21H19F6N6O7S2+ |
| Molecular Weight | 645.54 g/mol |
| Exact Mass | 645.07 |
| IUPAC Name | [[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-[[2-(trifluoromethyl)phenyl]sulfonylamino]methylidene]-methoxy-[2-(trifluoromethyl)phenyl]sulfonylazanium |
| SMILES | COc1nc(NC(NS(=O)(=O)c2ccccc2C(F)(F)F)=[N+](OC)S(=O)(=O)c2ccccc2C(F)(F)F)nc(OC)n1 |
| InChI | InChI=1S/C21H18F6N6O7S2/c1-38-18-29-16(30-19(31-18)39-2)28-17(32-41(34,35)14-10-6-4-8-12(14)20(22,23)24)33(40-3)42(36,37)15-11-7-5-9-13(15)21(25,26)27/h4-11H,1-3H3,(H,28,29,30,31,32)/p+1 |
| InChIKey | VFXCROWVFZUGSE-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 161.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|