C22H26N5O5S2+ — CID 54122083
[[(4,6-dimethylpyrimidin-2-yl)amino]-[(2-methylphenyl)sulfonylamino]methylidene]-methoxy-(2-methylphenyl)sulfonylazanium (PubChem CID 54122083) has the molecular formula C22H26N5O5S2+ and a molecular weight of 504.61 g/mol. Its IUPAC name is [[(4,6-dimethylpyrimidin-2-yl)amino]-[(2-methylphenyl)sulfonylamino]methylidene]-methoxy-(2-methylphenyl)sulfonylazanium.
| Compound Name | [[(4,6-dimethylpyrimidin-2-yl)amino]-[(2-methylphenyl)sulfonylamino]methylidene]-methoxy-(2-methylphenyl)sulfonylazanium |
|---|---|
| PubChem CID | 54122083 |
| Molecular Formula | C22H26N5O5S2+ |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | [[(4,6-dimethylpyrimidin-2-yl)amino]-[(2-methylphenyl)sulfonylamino]methylidene]-methoxy-(2-methylphenyl)sulfonylazanium |
| SMILES | CO[N+](=C(Nc1nc(C)cc(C)n1)NS(=O)(=O)c1ccccc1C)S(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C22H25N5O5S2/c1-15-10-6-8-12-19(15)33(28,29)26-22(25-21-23-17(3)14-18(4)24-21)27(32-5)34(30,31)20-13-9-7-11-16(20)2/h6-14H,1-5H3,(H,23,24,25,26)/p+1 |
| InChIKey | PJZCILNNQLMNAG-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|