C34H35NO4 — CID 56650472
diethyl 8,10,10-triphenyl-2,3,4,10a-tetrahydro-1H-pyrido[1,2-a]azepine-6,7-dicarboxylate (PubChem CID 56650472) has the molecular formula C34H35NO4 and a molecular weight of 521.66 g/mol. Its IUPAC name is diethyl 8,10,10-triphenyl-2,3,4,10a-tetrahydro-1H-pyrido[1,2-a]azepine-6,7-dicarboxylate.
| Compound Name | diethyl 8,10,10-triphenyl-2,3,4,10a-tetrahydro-1H-pyrido[1,2-a]azepine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 56650472 |
| Molecular Formula | C34H35NO4 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | diethyl 8,10,10-triphenyl-2,3,4,10a-tetrahydro-1H-pyrido[1,2-a]azepine-6,7-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N2CCCCC2C(c2ccccc2)(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C34H35NO4/c1-3-38-32(36)30-28(25-16-8-5-9-17-25)24-34(26-18-10-6-11-19-26,27-20-12-7-13-21-27)29-22-14-15-23-35(29)31(30)33(37)39-4-2/h5-13,16-21,24,29H,3-4,14-15,22-23H2,1-2H3 |
| InChIKey | FMUCCAHNWRKKQK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |