About 6-chloro-1,1-dimethyl-3,4-diphenylisochromene
6-chloro-1,1-dimethyl-3,4-diphenylisochromene (PubChem CID 56839038) has the molecular formula C23H19ClO
and a molecular weight of 346.86 g/mol. Its IUPAC name is 6-chloro-1,1-dimethyl-3,4-diphenylisochromene.
Molecular Properties
| Compound Name | 6-chloro-1,1-dimethyl-3,4-diphenylisochromene |
| PubChem CID | 56839038 |
| Molecular Formula | C23H19ClO |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 6-chloro-1,1-dimethyl-3,4-diphenylisochromene |
| SMILES | CC1(C)OC(c2ccccc2)=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H19ClO/c1-23(2)20-14-13-18(24)15-19(20)21(16-9-5-3-6-10-16)22(25-23)17-11-7-4-8-12-17/h3-15H,1-2H3 |
| InChIKey | KYTWZUAWIVZMAK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1,1-dimethyl-3,4-diphenylisochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,1-dimethyl-3,4-diphenylisochromene?
The IUPAC name of 6-chloro-1,1-dimethyl-3,4-diphenylisochromene (CID 56839038) is 6-chloro-1,1-dimethyl-3,4-diphenylisochromene.
What is the SMILES notation for 6-chloro-1,1-dimethyl-3,4-diphenylisochromene?
The canonical SMILES for 6-chloro-1,1-dimethyl-3,4-diphenylisochromene is CC1(C)OC(c2ccccc2)=C(c2ccccc2)c2cc(Cl)ccc21.
What is the InChIKey of 6-chloro-1,1-dimethyl-3,4-diphenylisochromene?
The InChIKey is KYTWZUAWIVZMAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19ClO/c1-23(2)20-14-13-18(24)15-19(20)21(16-9-5-3-6-10-16)22(25-23)17-11-7-4-8-12-17/h3-15H,1-2H3.
What are the key properties of 6-chloro-1,1-dimethyl-3,4-diphenylisochromene?
6-chloro-1,1-dimethyl-3,4-diphenylisochromene has a molecular weight of 346.86 g/mol, XLogP of 6.52, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,1-dimethyl-3,4-diphenylisochromene is sourced from PubChem (CID 56839038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).