C23H19ClO — CID 56839038
6-chloro-1,1-dimethyl-3,4-diphenylisochromene (PubChem CID 56839038) has the molecular formula C23H19ClO and a molecular weight of 346.86 g/mol. Its IUPAC name is 6-chloro-1,1-dimethyl-3,4-diphenylisochromene.
| Compound Name | 6-chloro-1,1-dimethyl-3,4-diphenylisochromene |
|---|---|
| PubChem CID | 56839038 |
| Molecular Formula | C23H19ClO |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 6-chloro-1,1-dimethyl-3,4-diphenylisochromene |
| SMILES | CC1(C)OC(c2ccccc2)=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H19ClO/c1-23(2)20-14-13-18(24)15-19(20)21(16-9-5-3-6-10-16)22(25-23)17-11-7-4-8-12-17/h3-15H,1-2H3 |
| InChIKey | KYTWZUAWIVZMAK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|