C30H36O5Si — CID 56945937
(1R,9R,11R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-9-methyl-8,12-dioxatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-ol (PubChem CID 56945937) has the molecular formula C30H36O5Si and a molecular weight of 504.70 g/mol. Its IUPAC name is (1R,9R,11R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-9-methyl-8,12-dioxatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-ol.
| Compound Name | (1R,9R,11R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-9-methyl-8,12-dioxatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-ol |
|---|---|
| PubChem CID | 56945937 |
| Molecular Formula | C30H36O5Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | (1R,9R,11R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-9-methyl-8,12-dioxatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-ol |
| SMILES | COc1cc(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc2c1[C@H]1C[C@](C)(C[C@H](O)O1)O2 |
| InChI | InChI=1S/C30H36O5Si/c1-29(2,3)36(22-12-8-6-9-13-22,23-14-10-7-11-15-23)33-20-21-16-24(32-5)28-25(17-21)35-30(4)18-26(28)34-27(31)19-30/h6-17,26-27,31H,18-20H2,1-5H3/t26-,27-,30-/m1/s1 |
| InChIKey | QXZGVHLZJUDBAA-YCVRVPNXSA-N |
| XLogP | 5.09 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|