C14H18O3 — CID 57022832
4-[(1S,2S,3R,6S)-2-ethynyl-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 57022832) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 4-[(1S,2S,3R,6S)-2-ethynyl-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | 4-[(1S,2S,3R,6S)-2-ethynyl-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 57022832 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 4-[(1S,2S,3R,6S)-2-ethynyl-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | C#C[C@@H]1[C@H]2CC(=CCCC(=O)O)[C@H]2CC[C@H]1O |
| InChI | InChI=1S/C14H18O3/c1-2-10-12-8-9(4-3-5-14(16)17)11(12)6-7-13(10)15/h1,4,10-13,15H,3,5-8H2,(H,16,17)/t10-,11-,12-,13-/m1/s1 |
| InChIKey | YOEHVZZXLGTNRJ-FDYHWXHSSA-N |
| XLogP | 1.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|