C20H24N2O4S2 — CID 57042207
[3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]methyl N-methylcarbamate (PubChem CID 57042207) has the molecular formula C20H24N2O4S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is [3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]methyl N-methylcarbamate.
| Compound Name | [3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 57042207 |
| Molecular Formula | C20H24N2O4S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | [3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1cccc(-c2ccc([C@@]3(CC(=O)NO)CCCCS3)s2)c1 |
| InChI | InChI=1S/C20H24N2O4S2/c1-21-19(24)26-13-14-5-4-6-15(11-14)16-7-8-17(28-16)20(12-18(23)22-25)9-2-3-10-27-20/h4-8,11,25H,2-3,9-10,12-13H2,1H3,(H,21,24)(H,22,23)/t20-/m0/s1 |
| InChIKey | SMUKZWDHQFGXKO-FQEVSTJZSA-N |
| XLogP | 4.28 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|