C32H37N3O6S2 — CID 57295273
benzyl N-[2-[3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]-2-oxoethyl]carbamate (PubChem CID 57295273) has the molecular formula C32H37N3O6S2 and a molecular weight of 623.80 g/mol. Its IUPAC name is benzyl N-[2-[3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 57295273 |
| Molecular Formula | C32H37N3O6S2 |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | benzyl N-[2-[3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]-2-oxoethyl]carbamate |
| SMILES | O=C(C[C@]1(c2ccc(-c3cccc(NC(=O)CNC(=O)OCc4ccccc4)c3)s2)CCCCS1)NOC1CCCCO1 |
| InChI | InChI=1S/C32H37N3O6S2/c36-28(35-41-30-13-4-6-17-39-30)20-32(16-5-7-18-42-32)27-15-14-26(43-27)24-11-8-12-25(19-24)34-29(37)21-33-31(38)40-22-23-9-2-1-3-10-23/h1-3,8-12,14-15,19,30H,4-7,13,16-18,20-22H2,(H,33,38)(H,34,37)(H,35,36)/t30?,32-/m0/s1 |
| InChIKey | KERPHKTUUTUHED-AUPVMFHISA-N |
| XLogP | 6.36 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|