C27H37N3O4S2 — CID 57078098
2-[(2S)-2-[5-[3-(butylcarbamoylamino)phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 57078098) has the molecular formula C27H37N3O4S2 and a molecular weight of 531.74 g/mol. Its IUPAC name is 2-[(2S)-2-[5-[3-(butylcarbamoylamino)phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[(2S)-2-[5-[3-(butylcarbamoylamino)phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 57078098 |
| Molecular Formula | C27H37N3O4S2 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 2-[(2S)-2-[5-[3-(butylcarbamoylamino)phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | CCCCNC(=O)Nc1cccc(-c2ccc([C@@]3(CC(=O)NOC4CCCCO4)CCCCS3)s2)c1 |
| InChI | InChI=1S/C27H37N3O4S2/c1-2-3-15-28-26(32)29-21-10-8-9-20(18-21)22-12-13-23(36-22)27(14-5-7-17-35-27)19-24(31)30-34-25-11-4-6-16-33-25/h8-10,12-13,18,25H,2-7,11,14-17,19H2,1H3,(H,30,31)(H2,28,29,32)/t25?,27-/m0/s1 |
| InChIKey | VRXPRDUEGZDNAR-GPNIZQGCSA-N |
| XLogP | 6.41 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|