C34H47N3O7S2 — CID 57071102
tert-butyl 4-[N-acetyl-3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]oxypiperidine-1-carboxylate (PubChem CID 57071102) has the molecular formula C34H47N3O7S2 and a molecular weight of 673.90 g/mol. Its IUPAC name is tert-butyl 4-[N-acetyl-3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[N-acetyl-3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 57071102 |
| Molecular Formula | C34H47N3O7S2 |
| Molecular Weight | 673.90 g/mol |
| Exact Mass | 673.29 |
| IUPAC Name | tert-butyl 4-[N-acetyl-3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]oxypiperidine-1-carboxylate |
| SMILES | CC(=O)N(OC1CCN(C(=O)OC(C)(C)C)CC1)c1cccc(-c2ccc([C@@]3(CC(=O)NOC4CCCCO4)CCCCS3)s2)c1 |
| InChI | InChI=1S/C34H47N3O7S2/c1-24(38)37(44-27-15-18-36(19-16-27)32(40)42-33(2,3)4)26-11-9-10-25(22-26)28-13-14-29(46-28)34(17-6-8-21-45-34)23-30(39)35-43-31-12-5-7-20-41-31/h9-11,13-14,22,27,31H,5-8,12,15-21,23H2,1-4H3,(H,35,39)/t31?,34-/m0/s1 |
| InChIKey | AGYSJGUDKXHLOQ-AEHIRBQFSA-N |
| XLogP | 7.18 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.90 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|