C26H34N2O5S2 — CID 57062887
2-[(2S)-2-[5-[3-[(2-ethoxyacetyl)amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 57062887) has the molecular formula C26H34N2O5S2 and a molecular weight of 518.70 g/mol. Its IUPAC name is 2-[(2S)-2-[5-[3-[(2-ethoxyacetyl)amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[(2S)-2-[5-[3-[(2-ethoxyacetyl)amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 57062887 |
| Molecular Formula | C26H34N2O5S2 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 2-[(2S)-2-[5-[3-[(2-ethoxyacetyl)amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | CCOCC(=O)Nc1cccc(-c2ccc([C@@]3(CC(=O)NOC4CCCCO4)CCCCS3)s2)c1 |
| InChI | InChI=1S/C26H34N2O5S2/c1-2-31-18-24(30)27-20-9-7-8-19(16-20)21-11-12-22(35-21)26(13-4-6-15-34-26)17-23(29)28-33-25-10-3-5-14-32-25/h7-9,11-12,16,25H,2-6,10,13-15,17-18H2,1H3,(H,27,30)(H,28,29)/t25?,26-/m0/s1 |
| InChIKey | MKZRKHWLSKRTKD-AMVUTOCUSA-N |
| XLogP | 5.47 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|