C30H35N3O5S2 — CID 57170994
2-[(2S)-2-[5-[3-[(4-methoxyphenyl)carbamoylamino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 57170994) has the molecular formula C30H35N3O5S2 and a molecular weight of 581.76 g/mol. Its IUPAC name is 2-[(2S)-2-[5-[3-[(4-methoxyphenyl)carbamoylamino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[(2S)-2-[5-[3-[(4-methoxyphenyl)carbamoylamino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 57170994 |
| Molecular Formula | C30H35N3O5S2 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 2-[(2S)-2-[5-[3-[(4-methoxyphenyl)carbamoylamino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | COc1ccc(NC(=O)Nc2cccc(-c3ccc([C@@]4(CC(=O)NOC5CCCCO5)CCCCS4)s3)c2)cc1 |
| InChI | InChI=1S/C30H35N3O5S2/c1-36-24-12-10-22(11-13-24)31-29(35)32-23-8-6-7-21(19-23)25-14-15-26(40-25)30(16-3-5-18-39-30)20-27(34)33-38-28-9-2-4-17-37-28/h6-8,10-15,19,28H,2-5,9,16-18,20H2,1H3,(H,33,34)(H2,31,32,35)/t28?,30-/m0/s1 |
| InChIKey | AEYIWFIOUZFOKH-TXDWVUBVSA-N |
| XLogP | 7.14 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|