C30H41N3O6S2 — CID 57092892
tert-butyl N-[(2S)-1-[3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]-1-oxopropan-2-yl]carbamate (PubChem CID 57092892) has the molecular formula C30H41N3O6S2 and a molecular weight of 603.81 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 57092892 |
| Molecular Formula | C30H41N3O6S2 |
| Molecular Weight | 603.81 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-[3-[5-[(2S)-2-[2-(oxan-2-yloxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]anilino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1cccc(-c2ccc([C@@]3(CC(=O)NOC4CCCCO4)CCCCS3)s2)c1 |
| InChI | InChI=1S/C30H41N3O6S2/c1-20(31-28(36)38-29(2,3)4)27(35)32-22-11-9-10-21(18-22)23-13-14-24(41-23)30(15-6-8-17-40-30)19-25(34)33-39-26-12-5-7-16-37-26/h9-11,13-14,18,20,26H,5-8,12,15-17,19H2,1-4H3,(H,31,36)(H,32,35)(H,33,34)/t20-,26?,30-/m0/s1 |
| InChIKey | PGELJUODVVFMLU-KXYCXDMKSA-N |
| XLogP | 6.34 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.81 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|