C22H26N2O4S2 — CID 57079533
N-[3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]oxolane-3-carboxamide (PubChem CID 57079533) has the molecular formula C22H26N2O4S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is N-[3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]oxolane-3-carboxamide.
| Compound Name | N-[3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 57079533 |
| Molecular Formula | C22H26N2O4S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[3-[5-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]thian-2-yl]thiophen-2-yl]phenyl]oxolane-3-carboxamide |
| SMILES | O=C(C[C@]1(c2ccc(-c3cccc(NC(=O)C4CCOC4)c3)s2)CCCCS1)NO |
| InChI | InChI=1S/C22H26N2O4S2/c25-20(24-27)13-22(9-1-2-11-29-22)19-7-6-18(30-19)15-4-3-5-17(12-15)23-21(26)16-8-10-28-14-16/h3-7,12,16,27H,1-2,8-11,13-14H2,(H,23,26)(H,24,25)/t16?,22-/m0/s1 |
| InChIKey | KHRGDDTVTUYLMZ-XLDIYJRPSA-N |
| XLogP | 4.40 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|