C31H36N2O6S2 — CID 57162690
2-[(2S)-2-[5-[3-[[2-(3-methoxyphenoxy)acetyl]amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 57162690) has the molecular formula C31H36N2O6S2 and a molecular weight of 596.77 g/mol. Its IUPAC name is 2-[(2S)-2-[5-[3-[[2-(3-methoxyphenoxy)acetyl]amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[(2S)-2-[5-[3-[[2-(3-methoxyphenoxy)acetyl]amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 57162690 |
| Molecular Formula | C31H36N2O6S2 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | 2-[(2S)-2-[5-[3-[[2-(3-methoxyphenoxy)acetyl]amino]phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | COc1cccc(OCC(=O)Nc2cccc(-c3ccc([C@@]4(CC(=O)NOC5CCCCO5)CCCCS4)s3)c2)c1 |
| InChI | InChI=1S/C31H36N2O6S2/c1-36-24-10-7-11-25(19-24)38-21-29(35)32-23-9-6-8-22(18-23)26-13-14-27(41-26)31(15-3-5-17-40-31)20-28(34)33-39-30-12-2-4-16-37-30/h6-11,13-14,18-19,30H,2-5,12,15-17,20-21H2,1H3,(H,32,35)(H,33,34)/t30?,31-/m0/s1 |
| InChIKey | XENFTMMOOYCYTA-FLDQDSGZSA-N |
| XLogP | 6.52 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|