C25H33N3O5S2 — CID 139929235
2-[(2S)-2-[5-[3-(methoxymethylcarbamoylamino)phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 139929235) has the molecular formula C25H33N3O5S2 and a molecular weight of 519.69 g/mol. Its IUPAC name is 2-[(2S)-2-[5-[3-(methoxymethylcarbamoylamino)phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[(2S)-2-[5-[3-(methoxymethylcarbamoylamino)phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 139929235 |
| Molecular Formula | C25H33N3O5S2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 2-[(2S)-2-[5-[3-(methoxymethylcarbamoylamino)phenyl]thiophen-2-yl]thian-2-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | COCNC(=O)Nc1cccc(-c2ccc([C@@]3(CC(=O)NOC4CCCCO4)CCCCS3)s2)c1 |
| InChI | InChI=1S/C25H33N3O5S2/c1-31-17-26-24(30)27-19-8-6-7-18(15-19)20-10-11-21(35-20)25(12-3-5-14-34-25)16-22(29)28-33-23-9-2-4-13-32-23/h6-8,10-11,15,23H,2-5,9,12-14,16-17H2,1H3,(H,28,29)(H2,26,27,30)/t23?,25-/m0/s1 |
| InChIKey | GDXIMZJWFXKUEK-YNMFNDETSA-N |
| XLogP | 5.22 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|